* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4,4'-DIETHOXY-2,2'-BIPYRIDINE |
CAS: | 53094-09-0 |
English Synonyms: | 4,4'-DIETHOXY-2,2'-BIPYRIDINE |
MDL Number.: | MFCD18427224 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCOc1ccnc(c1)c2cc(ccn2)OCC |
InChi: | InChI=1S/C14H16N2O2/c1-3-17-11-5-7-15-13(9-11)14-10-12(18-4-2)6-8-16-14/h5-10H,3-4H2,1-2H3 |
InChiKey: | InChIKey=VTWATEMKYKVGHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.