* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-PIPERIDINONE, 3,4-DIHYDROXY-5-METHYL-, (3R,4R,5R)- |
CAS: | 536744-86-2 |
English Synonyms: | 2-PIPERIDINONE, 3,4-DIHYDROXY-5-METHYL-, (3R,4R,5R)- |
MDL Number.: | MFCD18828313 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | C[C@@H]1CNC(=O)[C@@H]([C@@H]1O)O |
InChi: | InChI=1S/C6H11NO3/c1-3-2-7-6(10)5(9)4(3)8/h3-5,8-9H,2H2,1H3,(H,7,10)/t3-,4-,5-/m1/s1 |
InChiKey: | InChIKey=NTZKJRXXWZUJGO-UOWFLXDJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.