* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,5-DIETHYLPYRIDINE |
CAS: | 54119-29-8 |
English Synonyms: | 2,5-DIETHYLPYRIDINE |
MDL Number.: | MFCD00015542 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCc1ccc(nc1)CC |
InChi: | InChI=1S/C9H13N/c1-3-8-5-6-9(4-2)10-7-8/h5-7H,3-4H2,1-2H3 |
InChiKey: | InChIKey=IXFAHCCRDSSCPX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.