* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (4R,7R)-(-)-1,1,4,7,10,10-HEXAPHENYL-1,4,7,10-TETRAPHOSPHADECANE |
CAS: | 54294-46-1 ;23582-04-9 |
English Synonyms: | 1,1,4,7,10,10-HEXAPHENYL-1,4,7,10-TETRAPHOSPHADECANE ; (-)-TETRAPHOS ; (4R,7R)-(-)-1,1,4,7,10,10-HEXAPHENYL-1,4,7,10-TETRAPHOSPHADECANE |
MDL Number.: | MFCD00003049 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)P(CCP(CCP(c2ccccc2)c3ccccc3)c4ccccc4)CCP(c5ccccc5)c6ccccc6 |
InChi: | InChI=1S/C42H42P4/c1-7-19-37(20-8-1)43(33-35-45(39-23-11-3-12-24-39)40-25-13-4-14-26-40)31-32-44(38-21-9-2-10-22-38)34-36-46(41-27-15-5-16-28-41)42-29-17-6-18-30-42/h1-30H,31-36H2 |
InChiKey: | InChIKey=TXFNTLLEAYZBGV-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.