* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | COCSULININE |
CAS: | 54370-90-0 |
English Synonyms: | COCSULININE |
MDL Number.: | MFCD09837969 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CN1CCc2cc(c3c4c2[C@@H]1Cc5ccc(cc5)Oc6cc(ccc6O)C[C@H]7c8c(cc(c(c8O3)O4)OC)CCN7C)O |
InChi: | InChI=1S/C35H34N2O6/c1-36-12-10-21-17-27(39)32-34-30(21)24(36)14-19-4-7-23(8-5-19)41-28-16-20(6-9-26(28)38)15-25-31-22(11-13-37(25)2)18-29(40-3)33(43-34)35(31)42-32/h4-9,16-18,24-25,38-39H,10-15H2,1-3H3/t24-,25-/m0/s1 |
InChiKey: | InChIKey=IYGYFDDOHBCDFF-DQEYMECFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.