* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-(pyrrolidin-1-yl)pyridine |
CAS: | 54660-06-9 |
English Synonyms: | 2-(PYRROLIDIN-1-YL)PYRIDINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N1(CCCC1)C1=NC=CC=C1 |
InChi: | InChI=1S/C9H12N2/c1-2-6-10-9(5-1)11-7-3-4-8-11/h1-2,5-6H,3-4,7-8H2 |
InChiKey: | InChIKey=AZYTZQYCOBXDGY-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.