* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4H-PYRIMIDO[5,4-B]INDOL-4-ONE, 8-ETHYL-3,5-DIHYDRO- |
CAS: | 549488-48-4 |
English Synonyms: | 4H-PYRIMIDO[5,4-B]INDOL-4-ONE, 8-ETHYL-3,5-DIHYDRO- ; 8-ETHYL-3,5-DIHYDRO-4H-PYRIMIDO[5,4-B]INDOL-4-ONE |
MDL Number.: | MFCD17013901 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCc1ccc2c(c1)c3c([nH]2)c(=O)[nH]cn3 |
InChi: | InChI=1S/C12H11N3O/c1-2-7-3-4-9-8(5-7)10-11(15-9)12(16)14-6-13-10/h3-6,15H,2H2,1H3,(H,13,14,16) |
InChiKey: | InChIKey=VSXQGENJDSNTPE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.