* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDOLE-4,7-DIOL, 3-(2-AMINOETHYL)- |
CAS: | 55206-14-9 |
English Synonyms: | INDOLE-4,7-DIOL, 3-(2-AMINOETHYL)- ; 3-(2-AMINOETHYL)-INDOLE-4,7-DIOL ; 3-(2-AMINOETHYL)-1H-INDOLE-4,7-DIOL |
MDL Number.: | MFCD01718823 |
H bond acceptor: | 4 |
H bond donor: | 4 |
Smile: | c1cc(c2c(c1O)c(c[nH]2)CCN)O |
InChi: | InChI=1S/C10H12N2O2/c11-4-3-6-5-12-10-8(14)2-1-7(13)9(6)10/h1-2,5,12-14H,3-4,11H2 |
InChiKey: | InChIKey=CDOZGDYHEGFFLX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.