* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-(PROPAN-2-YL)-1,2-OXAZOL-3-AMINE |
CAS: | 55809-38-6 |
English Synonyms: | 5-(PROPAN-2-YL)-1,2-OXAZOL-3-AMINE ; 5-ISOPROPYLISOXAZOL-3-AMINE |
MDL Number.: | MFCD18379725 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)c1cc(no1)N |
InChi: | InChI=1S/C6H10N2O/c1-4(2)5-3-6(7)8-9-5/h3-4H,1-2H3,(H2,7,8) |
InChiKey: | InChIKey=AKJAMSGDZPHREW-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.