* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-OXAZOLIDINONE, 4-ETHYL-4-[2-(2-FURANYL)ETHENYL]-, (4R)- |
CAS: | 566938-27-0 |
English Synonyms: | 2-OXAZOLIDINONE, 4-ETHYL-4-[2-(2-FURANYL)ETHENYL]-, (4R)- |
MDL Number.: | MFCD18832066 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC[C@]1(COC(=O)N1)/C=C/c2ccco2 |
InChi: | InChI=1S/C11H13NO3/c1-2-11(8-15-10(13)12-11)6-5-9-4-3-7-14-9/h3-7H,2,8H2,1H3,(H,12,13)/b6-5+/t11-/m1/s1 |
InChiKey: | InChIKey=LAMZKQIFGILXDS-MVIFTORASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.