* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BICYCLO[2.2.2]OCTANE-2,5-DIONE |
| CAS: | 76478-53-0 ;57346-05-1 ;177931-43-0 |
| English Synonyms: | BICYCLO[2.2.2]OCTANE-2,5-DIONE ; (1R,4R)-BICYCLO[2.2.2]OCTANE-2,5-DIONE ; (1S,4S)-BICYCLO[2.2.2]OCTANE-2,5-DIONE |
| MDL Number.: | MFCD11044857 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C1C[C@H]2CC(=O)[C@@H]1CC2=O |
| InChi: | InChI=1S/C8H10O2/c9-7-4-6-2-1-5(7)3-8(6)10/h5-6H,1-4H2/t5-,6-/m0/s1 |
| InChiKey: | InChIKey=WMJKUNDVKHUCMV-WDSKDSINSA-N |
|
|
| Comments: | UNSPSC: 12352100 WGK: 3 |
|
|
| Symbol: |
GHS05
GHS07
|
| Signal word: | Danger |
| Hazard statements: | H302-H318 |
| Precautionary statements: | P280-P305 + P351 + P338 |
| hazard symbol: | Xn |
| Risk Code: | R:22-41 |
| Safe Code: | S:26-39 |
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.