* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | SPIRO[4.4]NONAN-1-OL, 6-AMINO-, (1S,5S,6S)- |
CAS: | 575342-92-6 |
English Synonyms: | SPIRO[4.4]NONAN-1-OL, 6-AMINO-, (1S,5S,6S)- |
MDL Number.: | MFCD18834467 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C1C[C@@H]([C@]2(C1)CCC[C@@H]2O)N |
InChi: | InChI=1S/C9H17NO/c10-7-3-1-5-9(7)6-2-4-8(9)11/h7-8,11H,1-6,10H2/t7-,8-,9-/m0/s1 |
InChiKey: | InChIKey=RMPOVHNVHWIJIZ-CIUDSAMLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.