* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (+)-PERILLYL ALCOHOL |
CAS: | 57717-97-2 |
English Synonyms: | D-(+)-PERILLYL ALCOHOL ; (+)-PERILLYL ALCOHOL |
MDL Number.: | MFCD00142333 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(=C)[C@@H]1CCC(=CC1)CO |
InChi: | InChI=1S/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,10-11H,1,4-7H2,2H3/t10-/m0/s1 |
InChiKey: | InChIKey=NDTYTMIUWGWIMO-JTQLQIEISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.