* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-IODO-2H-1-BENZOPYRAN-2-ONE |
CAS: | 57730-40-2 |
English Synonyms: | 6-IODO-2H-1-BENZOPYRAN-2-ONE ; 6-IODO-2H-CHROMEN-2-ONE ; 2H-1-BENZOPYRAN-2-ONE, 6-IODO- |
MDL Number.: | MFCD17215735 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc(=O)oc2c1cc(cc2)I |
InChi: | InChI=1S/C9H5IO2/c10-7-2-3-8-6(5-7)1-4-9(11)12-8/h1-5H |
InChiKey: | InChIKey=JMTPGBQVDFBWFT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.