* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 7-METHOXY-1,2,3,4,9,10-HEXAHYDROACRIDIN-9-ONE |
CAS: | 5778-47-2 |
English Synonyms: | 7-METHOXY-1,2,3,4,9,10-HEXAHYDROACRIDIN-9-ONE ; 7-METHOXY-1,2,3,4-TETRAHYDROACRIDIN-9(10H)-ONE |
MDL Number.: | MFCD09248457 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | COc1ccc2c(c1)c(=O)c3c([nH]2)CCCC3 |
InChi: | InChI=1S/C14H15NO2/c1-17-9-6-7-13-11(8-9)14(16)10-4-2-3-5-12(10)15-13/h6-8H,2-5H2,1H3,(H,15,16) |
InChiKey: | InChIKey=NAKOPQZYTOAWQJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.