* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,3-DI-2-PYRIDYL-2,3-BUTANEDIOL |
CAS: | 58052-51-0 |
English Synonyms: | 2,3-DI-2-PYRIDYL-2,3-BUTANEDIOL |
MDL Number.: | MFCD00010104 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(c1ccccn1)(C(C)(c2ccccn2)O)O |
InChi: | InChI=1S/C14H16N2O2/c1-13(17,11-7-3-5-9-15-11)14(2,18)12-8-4-6-10-16-12/h3-10,17-18H,1-2H3 |
InChiKey: | InChIKey=RUJGNUFYBYBFFP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.