* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-IODO-6-METHOXYPYRAZINE |
CAS: | 58139-03-0 |
English Synonyms: | 2-IODO-6-METHOXYPYRAZINE |
MDL Number.: | MFCD09265494 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | COc1cncc(n1)I |
InChi: | InChI=1S/C5H5IN2O/c1-9-5-3-7-2-4(6)8-5/h2-3H,1H3 |
InChiKey: | InChIKey=NSZWVUZALRZRLQ-UHFFFAOYSA-N |
|
|
Melting Point: | 36.6-38.1 DEG C |
Physical Property: | FLASHPOINT: >110 DEG C FLASHPOINT: >230 DEG F |
Comments: | WGK: 3 |
|
|
Symbol: |
![]() ![]() |
Signal word: | Danger |
Hazard statements: | H302-H315-H318-H335 |
Precautionary statements: | P261-P280-P305 + P351 + P338 |
hazard symbol: | Xn |
Risk Code: | R:10-22-37/38-41 |
Safe Code: | S:16-26-37 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.