* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1-[(3,5-DIAMINOPYRIDIN-2-YL)OXY]PROPAN-2-OL |
CAS: | 583049-05-2 |
English Synonyms: | 1-[(3,5-DIAMINOPYRIDIN-2-YL)OXY]PROPAN-2-OL ; 2-PROPANOL,1-[(3,5-DIAMINO-2-PYRIDINYL)OXY]- |
MDL Number.: | MFCD18815818 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(COc1c(cc(cn1)N)N)O |
InChi: | InChI=1S/C8H13N3O2/c1-5(12)4-13-8-7(10)2-6(9)3-11-8/h2-3,5,12H,4,9-10H2,1H3 |
InChiKey: | InChIKey=MLNJCJAHPAFIHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.