* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-METHYL-3-PROPYL-1,2-OXAZIRIDINE |
CAS: | 58657-06-0 |
English Synonyms: | 2-METHYL-3-PROPYL-1,2-OXAZIRIDINE |
MDL Number.: | MFCD18072410 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCCC1N(O1)C |
InChi: | InChI=1S/C5H11NO/c1-3-4-5-6(2)7-5/h5H,3-4H2,1-2H3 |
InChiKey: | InChIKey=QDNVKESMWBRZQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.