* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4-ETHOXYCARBONYL-9(10H)-ACRIDONE |
CAS: | 59749-05-2 |
English Synonyms: | 4-ETHOXYCARBONYL-9(10H)-ACRIDONE |
MDL Number.: | MFCD09951885 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC(=O)c1cccc2c1[nH]c3ccccc3c2=O |
InChi: | InChI=1S/C16H13NO3/c1-2-20-16(19)12-8-5-7-11-14(12)17-13-9-4-3-6-10(13)15(11)18/h3-9H,2H2,1H3,(H,17,18) |
InChiKey: | InChIKey=SIRYUKGFXNSSNP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.