* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-(2-CHLOROPHENYL)-1H-INDOLE |
CAS: | 599198-40-0 |
English Synonyms: | 5-(2-CHLOROPHENYL)-1H-INDOLE ; 1H-INDOLE, 5-(2-CHLOROPHENYL)- |
MDL Number.: | MFCD06802492 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)c2ccc3c(c2)cc[nH]3)Cl |
InChi: | InChI=1S/C14H10ClN/c15-13-4-2-1-3-12(13)10-5-6-14-11(9-10)7-8-16-14/h1-9,16H |
InChiKey: | InChIKey=INEDHQBEXZCAPI-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.