* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-ETHYL-3-METHYLPHENOL |
CAS: | 6161-62-2 |
English Synonyms: | 2-ETHYL-3-METHYLPHENOL ; PHENOL, 2-ETHYL-3-METHYL- |
MDL Number.: | MFCD16997563 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCc1c(cccc1O)C |
InChi: | InChI=1S/C9H12O/c1-3-8-7(2)5-4-6-9(8)10/h4-6,10H,3H2,1-2H3 |
InChiKey: | InChIKey=OCKYMBMCPOAFLL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.