* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | NOREXIMIDE |
CAS: | 6319-06-8 |
English Synonyms: | (3AR,4R,7S,7AS)-REL-3A,4,7,7A-TETRAHYDRO-4,7-METHANO-1H-ISOINDOLE-1,3(2H)-DIONE ; NOREXIMIDE |
MDL Number.: | MFCD01714861 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1[C@@H]2C=C[C@H]1[C@H]3[C@@H]2C(=O)NC3=O |
InChi: | InChI=1S/C9H9NO2/c11-8-6-4-1-2-5(3-4)7(6)9(12)10-8/h1-2,4-7H,3H2,(H,10,11,12)/t4-,5+,6+,7- |
InChiKey: | InChIKey=GPIUUMROPXDNRH-RNGGSSJXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.