* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-PROPENYLPHENOL |
| CAS: | 6380-21-8 |
| English Synonyms: | 2-[(1E)-PROP-1-EN-1-YL]PHENOL ; 2-PROPENYLPHENOL ; BIO-FARMA BF024328 ; 2-(PROP-1-EN-1-YL)PHENOL ; 2-[PROP-1-ENYL]PHENOL |
| MDL Number.: | MFCD00002248 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | C(=CC)C1=C(C=CC=C1)O |
| InChi: | InChI=1S/C9H10O/c1-2-5-8-6-3-4-7-9(8)10/h2-7,10H,1H3 |
| InChiKey: | InChIKey=WHGXZPQWZJUGEP-UHFFFAOYSA-N |
|
|
| Boiling Point: | 230-231 DEG C(LIT) |
| Density: | 1.044g/mLat25°C(lit.) |
| Physical Property: | FLASHPOINT: 195.8 DEG F FLASHPOINT: 91 DEG C REFRACTIVE INDEX: N20/D 1.578(LIT) |
| Comments: | RIDADR: UN 3145 8/PG 3 RTECS: SM8575000 UNSPSC: 12352100 WGK: 3 |
| Information: | MIXTURE OF CIS AND TRANS |
|
|
| Symbol: |
GHS07
|
| Signal word: | Warning |
| Hazard statements: | H315-H319-H335 |
| Precautionary statements: | P261-P305 + P351 + P338 |
| hazard symbol: | Xi |
| Risk Code: | R:36/37/38 |
| Safe Code: | S:26-36/37/39 |
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.