* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-SER-ALA-OH |
CAS: | 6403-17-4 |
English Synonyms: | H-SER-ALA-OH ; L-SERYL-L-ALANINE ; SER-ALA-OH |
MDL Number.: | MFCD00037228 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | C[C@@H](C(=O)O)NC(=O)[C@H](CO)N |
InChi: | InChI=1S/C6H12N2O4/c1-3(6(11)12)8-5(10)4(7)2-9/h3-4,9H,2,7H2,1H3,(H,8,10)(H,11,12)/t3-,4-/m0/s1 |
InChiKey: | InChIKey=SSJMZMUVNKEENT-IMJSIDKUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.