* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1458 |
CAS: | 66621-49-6 |
English Synonyms: | ABBYPHARMA AP-10-1458 |
MDL Number.: | MFCD16988077 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COC(=O)CC1=NC=CC(=O)N1 |
InChi: | InChI=1S/C7H8N2O3/c1-12-7(11)4-5-8-3-2-6(10)9-5/h2-3H,4H2,1H3,(H,8,9,10) |
InChiKey: | InChIKey=HDNOECXTRJDZGZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.