* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,3,7-TRIBROMO-2-FLUORENAMINE |
| CAS: | 724-31-2 |
| English Synonyms: | 1,3,7-TRIBROMO-2-FLUORENAMINE ; 2-AMINO-1,3,7-TRIBROMOFLUORENE |
| MDL Number.: | MFCD00032811 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1cc-2c(cc1Br)Cc3c2cc(c(c3Br)N)Br |
| InChi: | InChI=1S/C13H8Br3N/c14-7-1-2-8-6(3-7)4-10-9(8)5-11(15)13(17)12(10)16/h1-3,5H,4,17H2 |
| InChiKey: | InChIKey=DESWTTXWHWPCJD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.