* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SANDWICENSIN |
| CAS: | 74515-46-1 |
| English Synonyms: | SANDWICENSIN |
| MDL Number.: | MFCD11111297 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(=CCc1c(ccc2c1O[C@@H]3[C@H]2COc4c3ccc(c4)O)OC)C |
| InChi: | InChI=1S/C21H22O4/c1-12(2)4-6-15-18(23-3)9-8-14-17-11-24-19-10-13(22)5-7-16(19)21(17)25-20(14)15/h4-5,7-10,17,21-22H,6,11H2,1-3H3/t17-,21-/m0/s1 |
| InChiKey: | InChIKey=ZFUZIYGRFSXEIQ-UWJYYQICSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.