* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BOC-D-PHE-PRO-ARG-OH |
| CAS: | 74875-72-2 |
| English Synonyms: | BOC-D-PHE-PRO-ARG-OH |
| MDL Number.: | MFCD00038818 |
| H bond acceptor: | 12 |
| H bond donor: | 6 |
| Smile: | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| InChi: | InChI=1S/C25H38N6O6/c1-25(2,3)37-24(36)30-18(15-16-9-5-4-6-10-16)21(33)31-14-8-12-19(31)20(32)29-17(22(34)35)11-7-13-28-23(26)27/h4-6,9-10,17-19H,7-8,11-15H2,1-3H3,(H,29,32)(H,30,36)(H,34,35)(H4,26,27,28)/t17-,18+,19-/m0/s1 |
| InChiKey: | InChIKey=CBJCGSXEQDJZCG-OTWHNJEPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.