* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | MAL-EG(2)-COOH |
CAS: | 756525-98-1 |
English Synonyms: | MAL-DPEG2(TM) ACID ; MAL-EG(2)-COOH |
MDL Number.: | MFCD11041136 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | C1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCCC(=O)O |
InChi: | InChI=1S/C14H20N2O7/c17-11(3-6-16-12(18)1-2-13(16)19)15-5-8-23-10-9-22-7-4-14(20)21/h1-2H,3-10H2,(H,15,17)(H,20,21) |
InChiKey: | InChIKey=GBPJQBDDYXDSNH-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.