* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-PYRENEBUTANAL |
CAS: | 76868-32-1 |
English Synonyms: | 1-PYRENEBUTANAL |
MDL Number.: | MFCD12031852 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc2ccc3ccc(c4c3c2c(c1)cc4)CCCC=O |
InChi: | InChI=1S/C20H16O/c21-13-2-1-4-14-7-8-17-10-9-15-5-3-6-16-11-12-18(14)20(17)19(15)16/h3,5-13H,1-2,4H2 |
InChiKey: | InChIKey=MLLFBWYIQYKIED-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.