* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | DIZOCILPINE |
CAS: | 77086-21-6 ;70449-94-4 |
English Synonyms: | DIZOCILPINE ; MK-801 (DIZOCILPINE) |
MDL Number.: | MFCD06412575 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C[C@@]12c3ccccc3C[C@@H](N1)c4c2cccc4 |
InChi: | InChI=1S/C16H15N/c1-16-13-8-4-2-6-11(13)10-15(17-16)12-7-3-5-9-14(12)16/h2-9,15,17H,10H2,1H3/t15-,16+/m1/s1 |
InChiKey: | InChIKey=LBOJYSIDWZQNJS-CVEARBPZSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.