* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IBOXYGAINE |
| CAS: | 82-55-3 |
| English Synonyms: | IBOXYGAINE |
| MDL Number.: | MFCD09838076 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C[C@@H]([C@@H]1C[C@@H]2C[C@@H]3[C@H]1N(C2)CCc4c3[nH]c5c4cc(cc5)OC)O |
| InChi: | InChI=1S/C20H26N2O2/c1-11(23)15-7-12-8-17-19-14(5-6-22(10-12)20(15)17)16-9-13(24-2)3-4-18(16)21-19/h3-4,9,11-12,15,17,20-21,23H,5-8,10H2,1-2H3/t11-,12+,15-,17-,20-/m0/s1 |
| InChiKey: | InChIKey=QLSITYRYHBQHBY-BFRPBLBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.