* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PRODIGIOSIN |
| CAS: | 591771-60-7 ;82-89-3 |
| English Synonyms: | PRODIGIOSIN |
| MDL Number.: | MFCD01740630 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCCCCC1=C/C(=C/c2c(cc([nH]2)c3ccc[nH]3)OC)/N=C1C |
| InChi: | InChI=1S/C20H25N3O/c1-4-5-6-8-15-11-16(22-14(15)2)12-19-20(24-3)13-18(23-19)17-9-7-10-21-17/h7,9-13,21,23H,4-6,8H2,1-3H3/b16-12- |
| InChiKey: | InChIKey=SZXDNGVQRDTJSD-VBKFSLOCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.