* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,3,8-TRIMETHYL-2,3,6,9-TETRAHYDRO-1H-PURINE-2,6-DIONE |
| CAS: | 830-65-9 |
| English Synonyms: | 1,3,8-TRIMETHYL-1H-PURINE-2,6(3H,7H)-DIONE ; 1H-PURINE-2,6-DIONE, 3,9-DIHYDRO-1,3,8-TRIMETHYL- ; 1,3,8-TRIMETHYL-2,3,6,9-TETRAHYDRO-1H-PURINE-2,6-DIONE |
| MDL Number.: | MFCD01438434 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1[nH]c2c(n1)c(=O)n(c(=O)n2C)C |
| InChi: | InChI=1S/C8H10N4O2/c1-4-9-5-6(10-4)11(2)8(14)12(3)7(5)13/h1-3H3,(H,9,10) |
| InChiKey: | InChIKey=WZBKGWBHAPBSBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.