* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,2,4-OXADIAZOLE-3-CARBOXYLIC ACID |
| CAS: | 856787-15-0 |
| English Synonyms: | 1,2,4-OXADIAZOLE-3-CARBOXYLIC ACID |
| MDL Number.: | MFCD09414720 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1nc(no1)C(=O)O |
| InChi: | InChI=1S/C3H2N2O3/c6-3(7)2-4-1-8-5-2/h1H,(H,6,7) |
| InChiKey: | InChIKey=DOFBRSPSLRPIOW-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.