* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-AMINO-FURO[2,3-D]OXAZOL-6-OL |
| CAS: | 863012-82-2 |
| English Synonyms: | 2-AMINO-FURO[2,3-D]OXAZOL-6-OL ; FURO[2,3-D]OXAZOL-6-OL, 2-AMINO- ; 2-AMINOFURO[2,3-D][1,3]OXAZOL-6-OL |
| MDL Number.: | MFCD16878520 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1c(c2c(o1)nc(o2)N)O |
| InChi: | InChI=1S/C5H4N2O3/c6-5-7-4-3(10-5)2(8)1-9-4/h1,8H,(H2,6,7) |
| InChiKey: | InChIKey=ULZVGTVRIKQJNI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.