* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IMIDAZO[2,1-B]-1,3,4-THIADIAZOL-6-AMINE |
CAS: | 863203-54-7 |
English Synonyms: | IMIDAZO[2,1-B]-1,3,4-THIADIAZOL-6-AMINE |
MDL Number.: | MFCD17018303 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1c(nc2n1ncs2)N |
InChi: | InChI=1S/C4H4N4S/c5-3-1-8-4(7-3)9-2-6-8/h1-2H,5H2 |
InChiKey: | InChIKey=QFMJXNCOFUYYSP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.