* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1H-PYRROLO[3,4-E]-2,1,3-BENZOXADIAZOLE |
| CAS: | 873014-71-2 |
| English Synonyms: | 1H-PYRROLO[3,4-E]-2,1,3-BENZOXADIAZOLE |
| MDL Number.: | MFCD17018413 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc2c(c3c1cnc3)[nH]on2 |
| InChi: | InChI=1S/C8H5N3O/c1-2-7-8(11-12-10-7)6-4-9-3-5(1)6/h1-4,11H |
| InChiKey: | InChIKey=CZPXTPKICQGQBX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.