* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(2-THIENYL)BUT-3-EN-2-ONE |
| CAS: | 874-83-9 ;99768-07-7 ;33603-63-3 |
| English Synonyms: | 4-(2-THIENYL)BUT-3-EN-2-ONE ; 4-(THIOPHEN-2-YL)BUT-3-EN-2-ONE ; 4-(2-THIENYL)-3-BUTEN-2-ONE ; 1-(2-THIENYL)BUT-1-EN-3-ONE ; (E)-4-(THIOPHEN-2-YL)BUT-3-EN-2-ONE ; 1-(2-THIENYL)-1-BUTEN-3-ONE ; (3E)-4-(THIOPHEN-2-YL)BUT-3-EN-2-ONE ; TRANS-4-(2-THIENYL)-3-BUTEN-2-ONE |
| MDL Number.: | MFCD00053051 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(=O)/C=C/c1cccs1 |
| InChi: | InChI=1S/C8H8OS/c1-7(9)4-5-8-3-2-6-10-8/h2-6H,1H3/b5-4+ |
| InChiKey: | InChIKey=CIMALVIHZVKKPE-SNAWJCMRSA-N |
|
|
| Melting Point: | 24-29 DEG C(LIT) |
| Boiling Point: | 86-88DEG/1MM |
| Comments: | UNSPSC: 12352100 WGK: 3 |
|
|
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.