* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-HYDROXY-1H-INDOLE-5,6-DIAMINE |
| CAS: | 877469-90-4 |
| English Synonyms: | 1-HYDROXY-1H-INDOLE-5,6-DIAMINE ; 1H-INDOLE-5,6-DIAMINE, 1-HYDROXY- |
| MDL Number.: | MFCD16878897 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1cn(c2c1cc(c(c2)N)N)O |
| InChi: | InChI=1S/C8H9N3O/c9-6-3-5-1-2-11(12)8(5)4-7(6)10/h1-4,12H,9-10H2 |
| InChiKey: | InChIKey=PKPUIRUVTTWSSJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.