* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-PYRIDIN-4-YL-1H-INDAZOLE |
| CAS: | 885271-89-6 |
| English Synonyms: | 6-PYRIDIN-4-YL-1H-INDAZOLE ; INDAZOLE, 6-(4-PYRIDINYL)- |
| MDL Number.: | MFCD04114655 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2cn[nH]c2cc1c3ccncc3 |
| InChi: | InChI=1S/C12H9N3/c1-2-11-8-14-15-12(11)7-10(1)9-3-5-13-6-4-9/h1-8H,(H,14,15) |
| InChiKey: | InChIKey=LLNAANRKGDGDHY-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.