* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,4-DIAMIDINO-2,3,5,6-TETRAFLUOROBENZENE |
CAS: | 885958-45-2 |
English Synonyms: | 1,4-DIAMIDINO-2,3,5,6-TETRAFLUOROBENZENE |
MDL Number.: | MFCD05663077 |
H bond acceptor: | 4 |
H bond donor: | 4 |
Smile: | c1(c(c(c(c(c1F)F)C(=N)N)F)F)C(=N)N |
InChi: | InChI=1S/C8H6F4N4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H3,13,14)(H3,15,16) |
InChiKey: | InChIKey=KMUBDCOLCJILAB-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.