* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-(4-ETHYLPHENYL)-3-HYDRAZINO-1,2,4-TRIAZINE |
| CAS: | 915924-89-9 |
| English Synonyms: | 5-(4-ETHYLPHENYL)-3-HYDRAZINO-1,2,4-TRIAZINE |
| MDL Number.: | MFCD08691591 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCc1ccc(cc1)c2cnnc(n2)NN |
| InChi: | InChI=1S/C11H13N5/c1-2-8-3-5-9(6-4-8)10-7-13-16-11(14-10)15-12/h3-7H,2,12H2,1H3,(H,14,15,16) |
| InChiKey: | InChIKey=RTORDBDRTYVRHS-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.