* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(5-AMINOPYRIMIDIN-2-YL)ACETIC ACID |
| CAS: | 933686-69-2 |
| English Synonyms: | ABBYPHARMA AP-10-1770 ; 2-(5-AMINOPYRIMIDIN-2-YL)ACETIC ACID |
| MDL Number.: | MFCD16988206 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1c(cnc(n1)CC(=O)O)N |
| InChi: | InChI=1S/C6H7N3O2/c7-4-2-8-5(9-3-4)1-6(10)11/h2-3H,1,7H2,(H,10,11) |
| InChiKey: | InChIKey=SHYOUXPXKMGATQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.