* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | A-966492 |
| CAS: | 934162-61-5 |
| English Synonyms: | 2-[2-FLUORO-4-[(2S)-2-PYRROLIDINYL]PHENYL]-1H-BENZIMIDAZOLE-7-CARBOXAMIDE ; A-966492 |
| MDL Number.: | MFCD17215207 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | c1cc(c2c(c1)[nH]c(n2)c3ccc(cc3F)[C@@H]4CCCN4)C(=O)N |
| InChi: | InChI=1S/C18H17FN4O/c19-13-9-10(14-5-2-8-21-14)6-7-11(13)18-22-15-4-1-3-12(17(20)24)16(15)23-18/h1,3-4,6-7,9,14,21H,2,5,8H2,(H2,20,24)(H,22,23)/t14-/m0/s1 |
| InChiKey: | InChIKey=AHIVQGOUBLVTCB-AWEZNQCLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.