* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,4-DIETHYLPHENOL |
| CAS: | 936-89-0 |
| English Synonyms: | 2,4-DIETHYLPHENOL |
| MDL Number.: | MFCD16997702 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCc1ccc(c(c1)CC)O |
| InChi: | InChI=1S/C10H14O/c1-3-8-5-6-10(11)9(4-2)7-8/h5-7,11H,3-4H2,1-2H3 |
| InChiKey: | InChIKey=LMLAXOBGXCTWBJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.