* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,2,3-INDANTRIONE |
| CAS: | 938-24-9 |
| English Synonyms: | INDAN-1,2,3-TRIONE ; 1,2,3-INDANTRIONE ; 2,3-DIHYDRO-1H-INDENE-1,2,3-TRIONE ; 1H-INDENE-1,2,3-TRIONE |
| MDL Number.: | MFCD00066733 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)c(=O)c(=O)c2=O |
| InChi: | InChI=1S/C9H4O3/c10-7-5-3-1-2-4-6(5)8(11)9(7)12/h1-4H |
| InChiKey: | InChIKey=WVZWEMOFSIEEMU-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.