* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,4,5,6-TETRAHYDRO-2H-[1,2']BIPYRIDINYL-3-OL |
| CAS: | 939986-68-2 |
| English Synonyms: | 1-(PYRIDIN-2-YL)PIPERIDIN-3-OL ; 3,4,5,6-TETRAHYDRO-2H-[1,2']BIPYRIDINYL-3-OL |
| MDL Number.: | MFCD09607809 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccnc(c1)N2CCCC(C2)O |
| InChi: | InChI=1S/C10H14N2O/c13-9-4-3-7-12(8-9)10-5-1-2-6-11-10/h1-2,5-6,9,13H,3-4,7-8H2 |
| InChiKey: | InChIKey=MWCHBDDDUIMMLF-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.