* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-METHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL |
| CAS: | 946427-03-8 |
| English Synonyms: | 3-METHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL ; PHENOL, 3-METHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)- |
| MDL Number.: | MFCD16994280 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(cc2C)O |
| InChi: | InChI=1S/C13H19BO3/c1-9-8-10(15)6-7-11(9)14-16-12(2,3)13(4,5)17-14/h6-8,15H,1-5H3 |
| InChiKey: | InChIKey=KQELZLCLCNPDMC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.